C14H22N2 — CID 176962480
4-methyl-7-pentyl-1,2,3,4-tetrahydro-1,8-naphthyridine (PubChem CID 176962480) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 4-methyl-7-pentyl-1,2,3,4-tetrahydro-1,8-naphthyridine.
| Compound Name | 4-methyl-7-pentyl-1,2,3,4-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 176962480 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 4-methyl-7-pentyl-1,2,3,4-tetrahydro-1,8-naphthyridine |
| SMILES | CCCCCc1ccc2c(n1)NCCC2C |
| InChI | InChI=1S/C14H22N2/c1-3-4-5-6-12-7-8-13-11(2)9-10-15-14(13)16-12/h7-8,11H,3-6,9-10H2,1-2H3,(H,15,16) |
| InChIKey | CRQKQRHRYJPTAB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|