C33H47N4O6+ — CID 176970656
(3-carboxyphenyl)-[[4-(2,6-dimethylphenyl)-6-(2-methyl-3-propan-2-yloxydecoxy)pyrimidin-2-yl]amino]-dihydroxyazanium (PubChem CID 176970656) has the molecular formula C33H47N4O6+ and a molecular weight of 595.76 g/mol. Its IUPAC name is (3-carboxyphenyl)-[[4-(2,6-dimethylphenyl)-6-(2-methyl-3-propan-2-yloxydecoxy)pyrimidin-2-yl]amino]-dihydroxyazanium.
| Compound Name | (3-carboxyphenyl)-[[4-(2,6-dimethylphenyl)-6-(2-methyl-3-propan-2-yloxydecoxy)pyrimidin-2-yl]amino]-dihydroxyazanium |
|---|---|
| PubChem CID | 176970656 |
| Molecular Formula | C33H47N4O6+ |
| Molecular Weight | 595.76 g/mol |
| Exact Mass | 595.35 |
| IUPAC Name | (3-carboxyphenyl)-[[4-(2,6-dimethylphenyl)-6-(2-methyl-3-propan-2-yloxydecoxy)pyrimidin-2-yl]amino]-dihydroxyazanium |
| SMILES | CCCCCCCC(OC(C)C)C(C)COc1cc(-c2c(C)cccc2C)nc(N[N+](O)(O)c2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C33H46N4O6/c1-7-8-9-10-11-18-29(43-22(2)3)25(6)21-42-30-20-28(31-23(4)14-12-15-24(31)5)34-33(35-30)36-37(40,41)27-17-13-16-26(19-27)32(38)39/h12-17,19-20,22,25,29,40-41H,7-11,18,21H2,1-6H3,(H-,34,35,36,38,39)/p+1 |
| InChIKey | WOMXJUPFQUWPLQ-UHFFFAOYSA-O |
| XLogP | 7.74 |
| TPSA | 134.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.76 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|