C22H26ClN4O4+ — CID 176971141
(3-carboxyphenyl)-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]-dihydroxyazanium;propane (PubChem CID 176971141) has the molecular formula C22H26ClN4O4+ and a molecular weight of 445.93 g/mol. Its IUPAC name is (3-carboxyphenyl)-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]-dihydroxyazanium;propane.
| Compound Name | (3-carboxyphenyl)-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]-dihydroxyazanium;propane |
|---|---|
| PubChem CID | 176971141 |
| Molecular Formula | C22H26ClN4O4+ |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | (3-carboxyphenyl)-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]-dihydroxyazanium;propane |
| SMILES | CCC.Cc1cccc(C)c1-c1cc(Cl)nc(N[N+](O)(O)c2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C19H17ClN4O4.C3H8/c1-11-5-3-6-12(2)17(11)15-10-16(20)22-19(21-15)23-24(27,28)14-8-4-7-13(9-14)18(25)26;1-3-2/h3-10,27-28H,1-2H3,(H-,21,22,23,25,26);3H2,1-2H3/p+1 |
| InChIKey | GIUIAMGLIKUGBK-UHFFFAOYSA-O |
| XLogP | 5.64 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|