C28H28ClN5O2S — CID 167012519
3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-N-(3-hydroxypropyl)-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 167012519) has the molecular formula C28H28ClN5O2S and a molecular weight of 534.09 g/mol. Its IUPAC name is 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-N-(3-hydroxypropyl)-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-N-(3-hydroxypropyl)-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 167012519 |
| Molecular Formula | C28H28ClN5O2S |
| Molecular Weight | 534.09 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-N-(3-hydroxypropyl)-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | Cc1cccc(C)c1-c1cc(Cl)nc(NSc2cccc(C(=O)N(CCCO)Cc3ccccn3)c2)n1 |
| InChI | InChI=1S/C28H28ClN5O2S/c1-19-8-5-9-20(2)26(19)24-17-25(29)32-28(31-24)33-37-23-12-6-10-21(16-23)27(36)34(14-7-15-35)18-22-11-3-4-13-30-22/h3-6,8-13,16-17,35H,7,14-15,18H2,1-2H3,(H,31,32,33) |
| InChIKey | HPFJPFKUKGHHOR-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.09 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|