C12H13BrClN3O2S — CID 176973902
1-(2-bromo-4-chlorophenyl)-N-(1-cyanopyrrolidin-3-yl)methanesulfonamide (PubChem CID 176973902) has the molecular formula C12H13BrClN3O2S and a molecular weight of 378.68 g/mol. Its IUPAC name is 1-(2-bromo-4-chlorophenyl)-N-(1-cyanopyrrolidin-3-yl)methanesulfonamide.
| Compound Name | 1-(2-bromo-4-chlorophenyl)-N-(1-cyanopyrrolidin-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 176973902 |
| Molecular Formula | C12H13BrClN3O2S |
| Molecular Weight | 378.68 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | 1-(2-bromo-4-chlorophenyl)-N-(1-cyanopyrrolidin-3-yl)methanesulfonamide |
| SMILES | N#CN1CCC(NS(=O)(=O)Cc2ccc(Cl)cc2Br)C1 |
| InChI | InChI=1S/C12H13BrClN3O2S/c13-12-5-10(14)2-1-9(12)7-20(18,19)16-11-3-4-17(6-11)8-15/h1-2,5,11,16H,3-4,6-7H2 |
| InChIKey | IMUATILVXVPUGJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.68 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|