C11H14ClN4O2PS — CID 143880251
2-chloro-N-(1-cyanopyrrolidin-3-yl)-5-(phosphanylamino)benzenesulfonamide (PubChem CID 143880251) has the molecular formula C11H14ClN4O2PS and a molecular weight of 332.75 g/mol. Its IUPAC name is 2-chloro-N-(1-cyanopyrrolidin-3-yl)-5-(phosphanylamino)benzenesulfonamide.
| Compound Name | 2-chloro-N-(1-cyanopyrrolidin-3-yl)-5-(phosphanylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 143880251 |
| Molecular Formula | C11H14ClN4O2PS |
| Molecular Weight | 332.75 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 2-chloro-N-(1-cyanopyrrolidin-3-yl)-5-(phosphanylamino)benzenesulfonamide |
| SMILES | N#CN1CCC(NS(=O)(=O)c2cc(NP)ccc2Cl)C1 |
| InChI | InChI=1S/C11H14ClN4O2PS/c12-10-2-1-8(14-19)5-11(10)20(17,18)15-9-3-4-16(6-9)7-13/h1-2,5,9,14-15H,3-4,6,19H2 |
| InChIKey | CNMKNXRIJJTZIG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.75 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|