C22H30N3O+ — CID 176977724
N,N-diethyl-6,6,7-trimethyl-9-aza-6-azoniatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,10,12(16),13-pentaene-4-carboxamide (PubChem CID 176977724) has the molecular formula C22H30N3O+ and a molecular weight of 352.50 g/mol. Its IUPAC name is N,N-diethyl-6,6,7-trimethyl-9-aza-6-azoniatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,10,12(16),13-pentaene-4-carboxamide.
| Compound Name | N,N-diethyl-6,6,7-trimethyl-9-aza-6-azoniatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,10,12(16),13-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 176977724 |
| Molecular Formula | C22H30N3O+ |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | N,N-diethyl-6,6,7-trimethyl-9-aza-6-azoniatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,10,12(16),13-pentaene-4-carboxamide |
| SMILES | CCN(CC)C(=O)C1C=C2c3cccc4ccn(c34)CC2(C)[N+](C)(C)C1 |
| InChI | InChI=1S/C22H30N3O/c1-6-23(7-2)21(26)17-13-19-18-10-8-9-16-11-12-24(20(16)18)15-22(19,3)25(4,5)14-17/h8-13,17H,6-7,14-15H2,1-5H3/q+1 |
| InChIKey | LKHIMPHNUYVKPY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|