C14H14Cl3N5 — CID 176979189
2-chloro-4-N-[1-(2,4-dichlorophenyl)ethyl]-6-(methyliminomethyl)pyrimidine-4,5-diamine (PubChem CID 176979189) has the molecular formula C14H14Cl3N5 and a molecular weight of 358.66 g/mol. Its IUPAC name is 2-chloro-4-N-[1-(2,4-dichlorophenyl)ethyl]-6-(methyliminomethyl)pyrimidine-4,5-diamine.
| Compound Name | 2-chloro-4-N-[1-(2,4-dichlorophenyl)ethyl]-6-(methyliminomethyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 176979189 |
| Molecular Formula | C14H14Cl3N5 |
| Molecular Weight | 358.66 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 2-chloro-4-N-[1-(2,4-dichlorophenyl)ethyl]-6-(methyliminomethyl)pyrimidine-4,5-diamine |
| SMILES | C/N=C/c1nc(Cl)nc(NC(C)c2ccc(Cl)cc2Cl)c1N |
| InChI | InChI=1S/C14H14Cl3N5/c1-7(9-4-3-8(15)5-10(9)16)20-13-12(18)11(6-19-2)21-14(17)22-13/h3-7H,18H2,1-2H3,(H,20,21,22)/b19-6+ |
| InChIKey | KXDWABGWGOPXHP-KPSZGOFPSA-N |
| XLogP | 4.24 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.66 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|