C19H23FN4O5S — CID 176990215
methyl (2S,3R)-3-[[(S)-tert-butylsulfinyl]amino]-3-(3-fluorophenyl)-2-[(3-nitro-2-pyridinyl)amino]propanoate (PubChem CID 176990215) has the molecular formula C19H23FN4O5S and a molecular weight of 438.48 g/mol. Its IUPAC name is methyl (2S,3R)-3-[[(S)-tert-butylsulfinyl]amino]-3-(3-fluorophenyl)-2-[(3-nitro-2-pyridinyl)amino]propanoate.
| Compound Name | methyl (2S,3R)-3-[[(S)-tert-butylsulfinyl]amino]-3-(3-fluorophenyl)-2-[(3-nitro-2-pyridinyl)amino]propanoate |
|---|---|
| PubChem CID | 176990215 |
| Molecular Formula | C19H23FN4O5S |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | methyl (2S,3R)-3-[[(S)-tert-butylsulfinyl]amino]-3-(3-fluorophenyl)-2-[(3-nitro-2-pyridinyl)amino]propanoate |
| SMILES | COC(=O)[C@@H](Nc1ncccc1[N+](=O)[O-])[C@H](N[S@@](=O)C(C)(C)C)c1cccc(F)c1 |
| InChI | InChI=1S/C19H23FN4O5S/c1-19(2,3)30(28)23-15(12-7-5-8-13(20)11-12)16(18(25)29-4)22-17-14(24(26)27)9-6-10-21-17/h5-11,15-16,23H,1-4H3,(H,21,22)/t15-,16+,30+/m1/s1 |
| InChIKey | NTDRYJLSYACVDW-KKUWSCMFSA-N |
| XLogP | 2.88 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|