C31H35N5O2S — CID 176992985
tert-butyl 6-[2-[4-(4,5,9,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl)phenyl]ethynyl]-2-azaspiro[3.3]heptane-2-carboxylate (PubChem CID 176992985) has the molecular formula C31H35N5O2S and a molecular weight of 541.72 g/mol. Its IUPAC name is tert-butyl 6-[2-[4-(4,5,9,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl)phenyl]ethynyl]-2-azaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-[2-[4-(4,5,9,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl)phenyl]ethynyl]-2-azaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 176992985 |
| Molecular Formula | C31H35N5O2S |
| Molecular Weight | 541.72 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | tert-butyl 6-[2-[4-(4,5,9,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl)phenyl]ethynyl]-2-azaspiro[3.3]heptane-2-carboxylate |
| SMILES | Cc1sc2c(c1C)C(c1ccc(C#CC3CC4(C3)CN(C(=O)OC(C)(C)C)C4)cc1)=NC(C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C31H35N5O2S/c1-18-20(3)39-28-25(18)26(32-19(2)27-34-33-21(4)36(27)28)24-12-10-22(11-13-24)8-9-23-14-31(15-23)16-35(17-31)29(37)38-30(5,6)7/h10-13,19,23H,14-17H2,1-7H3 |
| InChIKey | VATVULZNXBTKMB-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.72 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|