C29H34N6O2S — CID 177319635
tert-butyl 2-[4-(4,5,9,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl)phenyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 177319635) has the molecular formula C29H34N6O2S and a molecular weight of 530.70 g/mol. Its IUPAC name is tert-butyl 2-[4-(4,5,9,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl)phenyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 2-[4-(4,5,9,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl)phenyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 177319635 |
| Molecular Formula | C29H34N6O2S |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | tert-butyl 2-[4-(4,5,9,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl)phenyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | Cc1sc2c(c1C)C(c1ccc(N3CC4=C(CN(C(=O)OC(C)(C)C)C4)C3)cc1)=NC(C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C29H34N6O2S/c1-16-18(3)38-27-24(16)25(30-17(2)26-32-31-19(4)35(26)27)20-8-10-23(11-9-20)33-12-21-14-34(15-22(21)13-33)28(36)37-29(5,6)7/h8-11,17H,12-15H2,1-7H3 |
| InChIKey | YFDVRNQQHIQDMG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 75.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|