C33H39N5O2S — CID 177266530
tert-butyl 2-[2-[4-[(9S)-4,5,9,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl]phenyl]ethynyl]-7-azaspiro[3.5]nonane-7-carboxylate (PubChem CID 177266530) has the molecular formula C33H39N5O2S and a molecular weight of 569.78 g/mol. Its IUPAC name is tert-butyl 2-[2-[4-[(9S)-4,5,9,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl]phenyl]ethynyl]-7-azaspiro[3.5]nonane-7-carboxylate.
| Compound Name | tert-butyl 2-[2-[4-[(9S)-4,5,9,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl]phenyl]ethynyl]-7-azaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 177266530 |
| Molecular Formula | C33H39N5O2S |
| Molecular Weight | 569.78 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | tert-butyl 2-[2-[4-[(9S)-4,5,9,13-tetramethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl]phenyl]ethynyl]-7-azaspiro[3.5]nonane-7-carboxylate |
| SMILES | Cc1sc2c(c1C)C(c1ccc(C#CC3CC4(CCN(C(=O)OC(C)(C)C)CC4)C3)cc1)=N[C@@H](C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C33H39N5O2S/c1-20-22(3)41-30-27(20)28(34-21(2)29-36-35-23(4)38(29)30)26-12-10-24(11-13-26)8-9-25-18-33(19-25)14-16-37(17-15-33)31(39)40-32(5,6)7/h10-13,21,25H,14-19H2,1-7H3/t21-/m0/s1 |
| InChIKey | UEOHIPHEYFYKJT-NRFANRHFSA-N |
| XLogP | 6.94 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.78 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|