C13H27BrN4O3S — CID 176993327
(1E,3E)-4-bromo-1-N'-methylbuta-1,3-diene-1,1,4-triamine;ethane;4-methylsulfinylmorpholine-3-carbaldehyde (PubChem CID 176993327) has the molecular formula C13H27BrN4O3S and a molecular weight of 399.36 g/mol. Its IUPAC name is (1E,3E)-4-bromo-1-N'-methylbuta-1,3-diene-1,1,4-triamine;ethane;4-methylsulfinylmorpholine-3-carbaldehyde.
| Compound Name | (1E,3E)-4-bromo-1-N'-methylbuta-1,3-diene-1,1,4-triamine;ethane;4-methylsulfinylmorpholine-3-carbaldehyde |
|---|---|
| PubChem CID | 176993327 |
| Molecular Formula | C13H27BrN4O3S |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (1E,3E)-4-bromo-1-N'-methylbuta-1,3-diene-1,1,4-triamine;ethane;4-methylsulfinylmorpholine-3-carbaldehyde |
| SMILES | CC.CN/C(N)=C/C=C(\N)Br.CS(=O)N1CCOCC1C=O |
| InChI | InChI=1S/C6H11NO3S.C5H10BrN3.C2H6/c1-11(9)7-2-3-10-5-6(7)4-8;1-9-5(8)3-2-4(6)7;1-2/h4,6H,2-3,5H2,1H3;2-3,9H,7-8H2,1H3;1-2H3/b;4-2-,5-3+; |
| InChIKey | BUBBHHXCGKSDKW-XJFZLBDMSA-N |
| XLogP | 0.41 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|