C14H27N5 — CID 176993407
N-methyl-N'-[2-[[(Z)-3-(methylideneamino)-1-pyrrolidin-1-ylbut-2-enylidene]amino]ethyl]ethane-1,2-diamine (PubChem CID 176993407) has the molecular formula C14H27N5 and a molecular weight of 265.40 g/mol. Its IUPAC name is N-methyl-N'-[2-[[(Z)-3-(methylideneamino)-1-pyrrolidin-1-ylbut-2-enylidene]amino]ethyl]ethane-1,2-diamine.
| Compound Name | N-methyl-N'-[2-[[(Z)-3-(methylideneamino)-1-pyrrolidin-1-ylbut-2-enylidene]amino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 176993407 |
| Molecular Formula | C14H27N5 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.23 |
| IUPAC Name | N-methyl-N'-[2-[[(Z)-3-(methylideneamino)-1-pyrrolidin-1-ylbut-2-enylidene]amino]ethyl]ethane-1,2-diamine |
| SMILES | C=N/C(C)=C\C(=N/CCNCCNC)N1CCCC1 |
| InChI | InChI=1S/C14H27N5/c1-13(16-3)12-14(19-10-4-5-11-19)18-9-8-17-7-6-15-2/h12,15,17H,3-11H2,1-2H3/b13-12-,18-14+ |
| InChIKey | AITLPPKJFJINGA-BFJFDWDHSA-N |
| XLogP | 0.89 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|