C17H22BIO3S — CID 176998545
ethane;2-[2-formyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl thiohypoiodite (PubChem CID 176998545) has the molecular formula C17H22BIO3S and a molecular weight of 444.14 g/mol. Its IUPAC name is ethane;2-[2-formyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl thiohypoiodite.
| Compound Name | ethane;2-[2-formyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl thiohypoiodite |
|---|---|
| PubChem CID | 176998545 |
| Molecular Formula | C17H22BIO3S |
| Molecular Weight | 444.14 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | ethane;2-[2-formyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl thiohypoiodite |
| SMILES | CC.CC1(C)OB(c2cccc(C#CSI)c2C=O)OC1(C)C |
| InChI | InChI=1S/C15H16BIO3S.C2H6/c1-14(2)15(3,4)20-16(19-14)13-7-5-6-11(8-9-21-17)12(13)10-18;1-2/h5-7,10H,1-4H3;1-2H3 |
| InChIKey | IRGFXJAMBCDZPV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.14 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|