C34H27F3N6O2S2 — CID 177007623
2-[5-[4-[2-methyl-1-[3-nitro-4-[[5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]methyl]phenyl]propan-2-yl]phenyl]-1,3,4-thiadiazol-2-yl]aniline (PubChem CID 177007623) has the molecular formula C34H27F3N6O2S2 and a molecular weight of 672.76 g/mol. Its IUPAC name is 2-[5-[4-[2-methyl-1-[3-nitro-4-[[5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]methyl]phenyl]propan-2-yl]phenyl]-1,3,4-thiadiazol-2-yl]aniline.
| Compound Name | 2-[5-[4-[2-methyl-1-[3-nitro-4-[[5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]methyl]phenyl]propan-2-yl]phenyl]-1,3,4-thiadiazol-2-yl]aniline |
|---|---|
| PubChem CID | 177007623 |
| Molecular Formula | C34H27F3N6O2S2 |
| Molecular Weight | 672.76 g/mol |
| Exact Mass | 672.16 |
| IUPAC Name | 2-[5-[4-[2-methyl-1-[3-nitro-4-[[5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]methyl]phenyl]propan-2-yl]phenyl]-1,3,4-thiadiazol-2-yl]aniline |
| SMILES | CC(C)(Cc1ccc(Cc2nnc(-c3ccc(C(F)(F)F)cc3)s2)c([N+](=O)[O-])c1)c1ccc(-c2nnc(-c3ccccc3N)s2)cc1 |
| InChI | InChI=1S/C34H27F3N6O2S2/c1-33(2,24-13-9-22(10-14-24)31-41-42-32(47-31)26-5-3-4-6-27(26)38)19-20-7-8-23(28(17-20)43(44)45)18-29-39-40-30(46-29)21-11-15-25(16-12-21)34(35,36)37/h3-17H,18-19,38H2,1-2H3 |
| InChIKey | UAJHUOUWAFXDMP-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.76 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|