C32H26BrN3O5 — CID 177010398
N-(4-bromo-2-nitro-3-phenylmethoxyphenyl)-2,6-bis(phenylmethoxy)pyridin-3-amine (PubChem CID 177010398) has the molecular formula C32H26BrN3O5 and a molecular weight of 612.48 g/mol. Its IUPAC name is N-(4-bromo-2-nitro-3-phenylmethoxyphenyl)-2,6-bis(phenylmethoxy)pyridin-3-amine.
| Compound Name | N-(4-bromo-2-nitro-3-phenylmethoxyphenyl)-2,6-bis(phenylmethoxy)pyridin-3-amine |
|---|---|
| PubChem CID | 177010398 |
| Molecular Formula | C32H26BrN3O5 |
| Molecular Weight | 612.48 g/mol |
| Exact Mass | 611.11 |
| IUPAC Name | N-(4-bromo-2-nitro-3-phenylmethoxyphenyl)-2,6-bis(phenylmethoxy)pyridin-3-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(OCc3ccccc3)nc2OCc2ccccc2)ccc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C32H26BrN3O5/c33-26-16-17-27(30(36(37)38)31(26)40-21-24-12-6-2-7-13-24)34-28-18-19-29(39-20-23-10-4-1-5-11-23)35-32(28)41-22-25-14-8-3-9-15-25/h1-19,34H,20-22H2 |
| InChIKey | TVHOKEGTHXNUAU-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.48 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|