C29H22N2O4 — CID 71469733
3-(4-nitrophenyl)-2,4-bis(phenylmethoxy)quinoline (PubChem CID 71469733) has the molecular formula C29H22N2O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-2,4-bis(phenylmethoxy)quinoline.
| Compound Name | 3-(4-nitrophenyl)-2,4-bis(phenylmethoxy)quinoline |
|---|---|
| PubChem CID | 71469733 |
| Molecular Formula | C29H22N2O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 3-(4-nitrophenyl)-2,4-bis(phenylmethoxy)quinoline |
| SMILES | O=[N+]([O-])c1ccc(-c2c(OCc3ccccc3)nc3ccccc3c2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H22N2O4/c32-31(33)24-17-15-23(16-18-24)27-28(34-19-21-9-3-1-4-10-21)25-13-7-8-14-26(25)30-29(27)35-20-22-11-5-2-6-12-22/h1-18H,19-20H2 |
| InChIKey | SWAYZOIIHWFSPQ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|