C31H63N3 — CID 177012743
N-[3-(dimethylamino)propyl]-N'-methyl-3-methylidene-N-(10-methylideneoctadecyl)pentane-1,5-diamine (PubChem CID 177012743) has the molecular formula C31H63N3 and a molecular weight of 477.87 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N'-methyl-3-methylidene-N-(10-methylideneoctadecyl)pentane-1,5-diamine.
| Compound Name | N-[3-(dimethylamino)propyl]-N'-methyl-3-methylidene-N-(10-methylideneoctadecyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 177012743 |
| Molecular Formula | C31H63N3 |
| Molecular Weight | 477.87 g/mol |
| Exact Mass | 477.50 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N'-methyl-3-methylidene-N-(10-methylideneoctadecyl)pentane-1,5-diamine |
| SMILES | C=C(CCCCCCCC)CCCCCCCCCN(CCCN(C)C)CCC(=C)CCNC |
| InChI | InChI=1S/C31H63N3/c1-7-8-9-10-14-17-21-30(2)22-18-15-12-11-13-16-19-27-34(28-20-26-33(5)6)29-24-31(3)23-25-32-4/h32H,2-3,7-29H2,1,4-6H3 |
| InChIKey | PVZMQWJJRNKGQR-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.87 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|