C19H37N5O7 — CID 177015473
6-amino-N-[1,3-bis(3-amino-3-oxopropoxy)-2-[(3-amino-3-oxopropoxy)methyl]propan-2-yl]hexanamide (PubChem CID 177015473) has the molecular formula C19H37N5O7 and a molecular weight of 447.53 g/mol. Its IUPAC name is 6-amino-N-[1,3-bis(3-amino-3-oxopropoxy)-2-[(3-amino-3-oxopropoxy)methyl]propan-2-yl]hexanamide.
| Compound Name | 6-amino-N-[1,3-bis(3-amino-3-oxopropoxy)-2-[(3-amino-3-oxopropoxy)methyl]propan-2-yl]hexanamide |
|---|---|
| PubChem CID | 177015473 |
| Molecular Formula | C19H37N5O7 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 6-amino-N-[1,3-bis(3-amino-3-oxopropoxy)-2-[(3-amino-3-oxopropoxy)methyl]propan-2-yl]hexanamide |
| SMILES | NCCCCCC(=O)NC(COCCC(N)=O)(COCCC(N)=O)COCCC(N)=O |
| InChI | InChI=1S/C19H37N5O7/c20-8-3-1-2-4-18(28)24-19(12-29-9-5-15(21)25,13-30-10-6-16(22)26)14-31-11-7-17(23)27/h1-14,20H2,(H2,21,25)(H2,22,26)(H2,23,27)(H,24,28) |
| InChIKey | IKDZKEZMWIKYMH-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 212.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|