C27H52N4O11 — CID 162468025
tert-butyl N-[1,3-bis[3-(3-amino-3-oxopropoxy)propoxy]-2-[3-(3-amino-3-oxopropoxy)propoxymethyl]propan-2-yl]carbamate (PubChem CID 162468025) has the molecular formula C27H52N4O11 and a molecular weight of 608.73 g/mol. Its IUPAC name is tert-butyl N-[1,3-bis[3-(3-amino-3-oxopropoxy)propoxy]-2-[3-(3-amino-3-oxopropoxy)propoxymethyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1,3-bis[3-(3-amino-3-oxopropoxy)propoxy]-2-[3-(3-amino-3-oxopropoxy)propoxymethyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 162468025 |
| Molecular Formula | C27H52N4O11 |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.36 |
| IUPAC Name | tert-butyl N-[1,3-bis[3-(3-amino-3-oxopropoxy)propoxy]-2-[3-(3-amino-3-oxopropoxy)propoxymethyl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(COCCCOCCC(N)=O)(COCCCOCCC(N)=O)COCCCOCCC(N)=O |
| InChI | InChI=1S/C27H52N4O11/c1-26(2,3)42-25(35)31-27(19-39-13-4-10-36-16-7-22(28)32,20-40-14-5-11-37-17-8-23(29)33)21-41-15-6-12-38-18-9-24(30)34/h4-21H2,1-3H3,(H2,28,32)(H2,29,33)(H2,30,34)(H,31,35) |
| InChIKey | ZOMXQAQMVJKBEK-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 222.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|