C20H45N5O4 — CID 90147930
[1,3-bis[3-(ethylamino)propoxy]-2-[3-(ethylamino)propoxymethyl]propan-2-yl]urea (PubChem CID 90147930) has the molecular formula C20H45N5O4 and a molecular weight of 419.61 g/mol. Its IUPAC name is [1,3-bis[3-(ethylamino)propoxy]-2-[3-(ethylamino)propoxymethyl]propan-2-yl]urea.
| Compound Name | [1,3-bis[3-(ethylamino)propoxy]-2-[3-(ethylamino)propoxymethyl]propan-2-yl]urea |
|---|---|
| PubChem CID | 90147930 |
| Molecular Formula | C20H45N5O4 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.35 |
| IUPAC Name | [1,3-bis[3-(ethylamino)propoxy]-2-[3-(ethylamino)propoxymethyl]propan-2-yl]urea |
| SMILES | CCNCCCOCC(COCCCNCC)(COCCCNCC)NC(N)=O |
| InChI | InChI=1S/C20H45N5O4/c1-4-22-10-7-13-27-16-20(25-19(21)26,17-28-14-8-11-23-5-2)18-29-15-9-12-24-6-3/h22-24H,4-18H2,1-3H3,(H3,21,25,26) |
| InChIKey | HEPFRWQVSOMXND-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|