C22H25F3N4O6 — CID 177015650
propan-2-yl 4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]benzoate (PubChem CID 177015650) has the molecular formula C22H25F3N4O6 and a molecular weight of 498.46 g/mol. Its IUPAC name is propan-2-yl 4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]benzoate.
| Compound Name | propan-2-yl 4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 177015650 |
| Molecular Formula | C22H25F3N4O6 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | propan-2-yl 4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(C(=O)NC[C@H]2OC[C@H](Nc3cncc(C(F)(F)F)n3)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C22H25F3N4O6/c1-11(2)35-21(33)13-5-3-12(4-6-13)20(32)27-7-15-19(31)18(30)14(10-34-15)28-17-9-26-8-16(29-17)22(23,24)25/h3-6,8-9,11,14-15,18-19,30-31H,7,10H2,1-2H3,(H,27,32)(H,28,29)/t14-,15+,18+,19-/m0/s1 |
| InChIKey | XHCUNJPPLYYJLE-SFUIVIKGSA-N |
| XLogP | 1.39 |
| TPSA | 142.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |