C18H27F4N3O5 — CID 177015799
methyl (NZ)-N'-methyl-N-propylidenecarbamimidate;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite (PubChem CID 177015799) has the molecular formula C18H27F4N3O5 and a molecular weight of 441.42 g/mol. Its IUPAC name is methyl (NZ)-N'-methyl-N-propylidenecarbamimidate;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite.
| Compound Name | methyl (NZ)-N'-methyl-N-propylidenecarbamimidate;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
|---|---|
| PubChem CID | 177015799 |
| Molecular Formula | C18H27F4N3O5 |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | methyl (NZ)-N'-methyl-N-propylidenecarbamimidate;2-methyloxane-3,4-diol;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
| SMILES | CC/C=N\C(=N\C)OC.CC1OCCC(O)C1O.FOc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C6H3F4NO.C6H12N2O.C6H12O3/c7-6(8,9)4-2-1-3-5(11-4)12-10;1-4-5-8-6(7-2)9-3;1-4-6(8)5(7)2-3-9-4/h1-3H;5H,4H2,1-3H3;4-8H,2-3H2,1H3/b;7-6-,8-5-; |
| InChIKey | BRGOUGKUCBOYJI-FEDOYRPGSA-N |
| XLogP | 2.98 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|