C26H22Cl2FN5O3 — CID 177021098
7-(3-aminopropoxy)-4-[2-chloro-4-[(6-chloro-2-pyridinyl)methoxy]-5-fluoroanilino]-6-methoxyquinoline-3-carbonitrile (PubChem CID 177021098) has the molecular formula C26H22Cl2FN5O3 and a molecular weight of 542.40 g/mol. Its IUPAC name is 7-(3-aminopropoxy)-4-[2-chloro-4-[(6-chloro-2-pyridinyl)methoxy]-5-fluoroanilino]-6-methoxyquinoline-3-carbonitrile.
| Compound Name | 7-(3-aminopropoxy)-4-[2-chloro-4-[(6-chloro-2-pyridinyl)methoxy]-5-fluoroanilino]-6-methoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 177021098 |
| Molecular Formula | C26H22Cl2FN5O3 |
| Molecular Weight | 542.40 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | 7-(3-aminopropoxy)-4-[2-chloro-4-[(6-chloro-2-pyridinyl)methoxy]-5-fluoroanilino]-6-methoxyquinoline-3-carbonitrile |
| SMILES | COc1cc2c(Nc3cc(F)c(OCc4cccc(Cl)n4)cc3Cl)c(C#N)cnc2cc1OCCCN |
| InChI | InChI=1S/C26H22Cl2FN5O3/c1-35-23-8-17-20(11-24(23)36-7-3-6-30)32-13-15(12-31)26(17)34-21-10-19(29)22(9-18(21)27)37-14-16-4-2-5-25(28)33-16/h2,4-5,8-11,13H,3,6-7,14,30H2,1H3,(H,32,34) |
| InChIKey | XBZBPQOUBTUBMU-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.40 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|