C29H36FN3O4 — CID 177021358
[(2R)-2-[[5-[4-(2-fluoropropan-2-yl)phenoxy]naphthalene-2-carbonyl]amino]propyl] (2S)-2,6-diaminohexanoate (PubChem CID 177021358) has the molecular formula C29H36FN3O4 and a molecular weight of 509.62 g/mol. Its IUPAC name is [(2R)-2-[[5-[4-(2-fluoropropan-2-yl)phenoxy]naphthalene-2-carbonyl]amino]propyl] (2S)-2,6-diaminohexanoate.
| Compound Name | [(2R)-2-[[5-[4-(2-fluoropropan-2-yl)phenoxy]naphthalene-2-carbonyl]amino]propyl] (2S)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 177021358 |
| Molecular Formula | C29H36FN3O4 |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | [(2R)-2-[[5-[4-(2-fluoropropan-2-yl)phenoxy]naphthalene-2-carbonyl]amino]propyl] (2S)-2,6-diaminohexanoate |
| SMILES | C[C@H](COC(=O)[C@@H](N)CCCCN)NC(=O)c1ccc2c(Oc3ccc(C(C)(C)F)cc3)cccc2c1 |
| InChI | InChI=1S/C29H36FN3O4/c1-19(18-36-28(35)25(32)8-4-5-16-31)33-27(34)21-10-15-24-20(17-21)7-6-9-26(24)37-23-13-11-22(12-14-23)29(2,3)30/h6-7,9-15,17,19,25H,4-5,8,16,18,31-32H2,1-3H3,(H,33,34)/t19-,25+/m1/s1 |
| InChIKey | ZNHQREMJGQQPAM-CLOONOSVSA-N |
| XLogP | 4.95 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|