C9H15N3OS — CID 177031494
4-(5-propan-2-yl-1,2,4-thiadiazol-3-yl)morpholine (PubChem CID 177031494) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 4-(5-propan-2-yl-1,2,4-thiadiazol-3-yl)morpholine.
| Compound Name | 4-(5-propan-2-yl-1,2,4-thiadiazol-3-yl)morpholine |
|---|---|
| PubChem CID | 177031494 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 4-(5-propan-2-yl-1,2,4-thiadiazol-3-yl)morpholine |
| SMILES | CC(C)c1nc(N2CCOCC2)ns1 |
| InChI | InChI=1S/C9H15N3OS/c1-7(2)8-10-9(11-14-8)12-3-5-13-6-4-12/h7H,3-6H2,1-2H3 |
| InChIKey | JYWNYUHSNZQUJN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |