About 1-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethanamine;hydrochloride
1-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethanamine;hydrochloride (PubChem CID 166761027) has the molecular formula C9H17ClN4S
and a molecular weight of 248.78 g/mol. Its IUPAC name is 1-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethanamine;hydrochloride |
| PubChem CID | 166761027 |
| Molecular Formula | C9H17ClN4S |
| Molecular Weight | 248.78 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 1-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethanamine;hydrochloride |
| SMILES | CC(N)c1nc(N2CCCCC2)ns1.Cl |
| InChI | InChI=1S/C9H16N4S.ClH/c1-7(10)8-11-9(12-14-8)13-5-3-2-4-6-13;/h7H,2-6,10H2,1H3;1H |
| InChIKey | QSWKXVPNCZGRNN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.78 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethanamine;hydrochloride?
The IUPAC name of 1-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethanamine;hydrochloride (CID 166761027) is 1-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethanamine;hydrochloride.
What is the SMILES notation for 1-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethanamine;hydrochloride?
The canonical SMILES for 1-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethanamine;hydrochloride is CC(N)c1nc(N2CCCCC2)ns1.Cl.
What is the InChIKey of 1-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethanamine;hydrochloride?
The InChIKey is QSWKXVPNCZGRNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4S.ClH/c1-7(10)8-11-9(12-14-8)13-5-3-2-4-6-13;/h7H,2-6,10H2,1H3;1H.
What are the key properties of 1-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethanamine;hydrochloride?
1-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethanamine;hydrochloride has a molecular weight of 248.78 g/mol, XLogP of 1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethanamine;hydrochloride is sourced from PubChem (CID 166761027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).