C9H11N3OS — CID 175495064
2-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethenone (PubChem CID 175495064) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethenone.
| Compound Name | 2-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethenone |
|---|---|
| PubChem CID | 175495064 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 2-(3-piperidin-1-yl-1,2,4-thiadiazol-5-yl)ethenone |
| SMILES | O=C=Cc1nc(N2CCCCC2)ns1 |
| InChI | InChI=1S/C9H11N3OS/c13-7-4-8-10-9(11-14-8)12-5-2-1-3-6-12/h4H,1-3,5-6H2 |
| InChIKey | NQINOBSWZONXNE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|