C9H16N4S — CID 65269203
N-ethyl-3-piperidin-1-yl-1,2,4-thiadiazol-5-amine (PubChem CID 65269203) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is N-ethyl-3-piperidin-1-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-ethyl-3-piperidin-1-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65269203 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | N-ethyl-3-piperidin-1-yl-1,2,4-thiadiazol-5-amine |
| SMILES | CCNc1nc(N2CCCCC2)ns1 |
| InChI | InChI=1S/C9H16N4S/c1-2-10-9-11-8(12-14-9)13-6-4-3-5-7-13/h2-7H2,1H3,(H,10,11,12) |
| InChIKey | FHCKMMBSDRMBJC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |