C19H26F3NO2 — CID 177034521
hept-1-en-3-one;4-[2-methyl-4-(trifluoromethyl)phenyl]morpholine (PubChem CID 177034521) has the molecular formula C19H26F3NO2 and a molecular weight of 357.42 g/mol. Its IUPAC name is hept-1-en-3-one;4-[2-methyl-4-(trifluoromethyl)phenyl]morpholine.
| Compound Name | hept-1-en-3-one;4-[2-methyl-4-(trifluoromethyl)phenyl]morpholine |
|---|---|
| PubChem CID | 177034521 |
| Molecular Formula | C19H26F3NO2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | hept-1-en-3-one;4-[2-methyl-4-(trifluoromethyl)phenyl]morpholine |
| SMILES | C=CC(=O)CCCC.Cc1cc(C(F)(F)F)ccc1N1CCOCC1 |
| InChI | InChI=1S/C12H14F3NO.C7H12O/c1-9-8-10(12(13,14)15)2-3-11(9)16-4-6-17-7-5-16;1-3-5-6-7(8)4-2/h2-3,8H,4-7H2,1H3;4H,2-3,5-6H2,1H3 |
| InChIKey | WXZBNCJKQUTGQI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|