C17H16BrNO3 — CID 177035245
benzyl N-[(3R)-5-(bromomethyl)-2,3-dihydro-1-benzofuran-3-yl]carbamate (PubChem CID 177035245) has the molecular formula C17H16BrNO3 and a molecular weight of 362.22 g/mol. Its IUPAC name is benzyl N-[(3R)-5-(bromomethyl)-2,3-dihydro-1-benzofuran-3-yl]carbamate.
| Compound Name | benzyl N-[(3R)-5-(bromomethyl)-2,3-dihydro-1-benzofuran-3-yl]carbamate |
|---|---|
| PubChem CID | 177035245 |
| Molecular Formula | C17H16BrNO3 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | benzyl N-[(3R)-5-(bromomethyl)-2,3-dihydro-1-benzofuran-3-yl]carbamate |
| SMILES | O=C(N[C@H]1COc2ccc(CBr)cc21)OCc1ccccc1 |
| InChI | InChI=1S/C17H16BrNO3/c18-9-13-6-7-16-14(8-13)15(11-21-16)19-17(20)22-10-12-4-2-1-3-5-12/h1-8,15H,9-11H2,(H,19,20)/t15-/m0/s1 |
| InChIKey | CYXCTFJBUZUDNM-HNNXBMFYSA-N |
| XLogP | 3.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|