C17H14N2O3 — CID 177038556
2-methyl-5-[(1R)-2-pyrazin-2-ylcyclopropyl]-1-benzofuran-3-carboxylic acid (PubChem CID 177038556) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-methyl-5-[(1R)-2-pyrazin-2-ylcyclopropyl]-1-benzofuran-3-carboxylic acid.
| Compound Name | 2-methyl-5-[(1R)-2-pyrazin-2-ylcyclopropyl]-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 177038556 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-methyl-5-[(1R)-2-pyrazin-2-ylcyclopropyl]-1-benzofuran-3-carboxylic acid |
| SMILES | Cc1oc2ccc([C@@H]3CC3c3cnccn3)cc2c1C(=O)O |
| InChI | InChI=1S/C17H14N2O3/c1-9-16(17(20)21)13-6-10(2-3-15(13)22-9)11-7-12(11)14-8-18-4-5-19-14/h2-6,8,11-12H,7H2,1H3,(H,20,21)/t11-,12?/m0/s1 |
| InChIKey | WCURFFNJIPKIQB-PXYINDEMSA-N |
| XLogP | 3.50 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |