C9H15N5 — CID 177040135
2,8-dimethylimidazo[1,2-a]pyrazin-6-amine;methanamine (PubChem CID 177040135) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2,8-dimethylimidazo[1,2-a]pyrazin-6-amine;methanamine.
| Compound Name | 2,8-dimethylimidazo[1,2-a]pyrazin-6-amine;methanamine |
|---|---|
| PubChem CID | 177040135 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 2,8-dimethylimidazo[1,2-a]pyrazin-6-amine;methanamine |
| SMILES | CN.Cc1cn2cc(N)nc(C)c2n1 |
| InChI | InChI=1S/C8H10N4.CH5N/c1-5-3-12-4-7(9)11-6(2)8(12)10-5;1-2/h3-4H,9H2,1-2H3;2H2,1H3 |
| InChIKey | FTNMSCHFUYIICU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 82.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |