C18H15F3N2O2 — CID 177043817
N-[3-nitroso-5-(trifluoromethyl)phenyl]-2-phenylpent-4-enamide (PubChem CID 177043817) has the molecular formula C18H15F3N2O2 and a molecular weight of 348.32 g/mol. Its IUPAC name is N-[3-nitroso-5-(trifluoromethyl)phenyl]-2-phenylpent-4-enamide.
| Compound Name | N-[3-nitroso-5-(trifluoromethyl)phenyl]-2-phenylpent-4-enamide |
|---|---|
| PubChem CID | 177043817 |
| Molecular Formula | C18H15F3N2O2 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[3-nitroso-5-(trifluoromethyl)phenyl]-2-phenylpent-4-enamide |
| SMILES | C=CCC(C(=O)Nc1cc(N=O)cc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C18H15F3N2O2/c1-2-6-16(12-7-4-3-5-8-12)17(24)22-14-9-13(18(19,20)21)10-15(11-14)23-25/h2-5,7-11,16H,1,6H2,(H,22,24) |
| InChIKey | GDBOWPINTWXICV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|