C7H13N3 — CID 177044565
(1E)-2-N,3-dimethyl-1-(methylideneamino)buta-1,3-diene-1,2-diamine (PubChem CID 177044565) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is (1E)-2-N,3-dimethyl-1-(methylideneamino)buta-1,3-diene-1,2-diamine.
| Compound Name | (1E)-2-N,3-dimethyl-1-(methylideneamino)buta-1,3-diene-1,2-diamine |
|---|---|
| PubChem CID | 177044565 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | (1E)-2-N,3-dimethyl-1-(methylideneamino)buta-1,3-diene-1,2-diamine |
| SMILES | C=N/C(N)=C(/NC)C(=C)C |
| InChI | InChI=1S/C7H13N3/c1-5(2)6(9-3)7(8)10-4/h9H,1,4,8H2,2-3H3/b7-6+ |
| InChIKey | IZUKGGXGFSMAFT-VOTSOKGWSA-N |
| XLogP | 0.61 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|