About ethane;methyl(2-methylbutanoyl)azanide;yttrium
ethane;methyl(2-methylbutanoyl)azanide;yttrium (PubChem CID 177048514) has the molecular formula C8H18NOY-
and a molecular weight of 233.14 g/mol. Its IUPAC name is ethane;methyl(2-methylbutanoyl)azanide;yttrium.
Molecular Properties
| Compound Name | ethane;methyl(2-methylbutanoyl)azanide;yttrium |
| PubChem CID | 177048514 |
| Molecular Formula | C8H18NOY- |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | ethane;methyl(2-methylbutanoyl)azanide;yttrium |
| SMILES | CC.CCC(C)C(=O)[N-]C.[Y] |
| InChI | InChI=1S/C6H13NO.C2H6.Y/c1-4-5(2)6(8)7-3;1-2;/h5H,4H2,1-3H3,(H,7,8);1-2H3;/p-1 |
| InChIKey | CASBULOBXQJCIU-UHFFFAOYSA-M |
| XLogP | 2.59 |
| TPSA | 31.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;methyl(2-methylbutanoyl)azanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl(2-methylbutanoyl)azanide;yttrium?
The IUPAC name of ethane;methyl(2-methylbutanoyl)azanide;yttrium (CID 177048514) is ethane;methyl(2-methylbutanoyl)azanide;yttrium.
What is the SMILES notation for ethane;methyl(2-methylbutanoyl)azanide;yttrium?
The canonical SMILES for ethane;methyl(2-methylbutanoyl)azanide;yttrium is CC.CCC(C)C(=O)[N-]C.[Y].
What is the InChIKey of ethane;methyl(2-methylbutanoyl)azanide;yttrium?
The InChIKey is CASBULOBXQJCIU-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H13NO.C2H6.Y/c1-4-5(2)6(8)7-3;1-2;/h5H,4H2,1-3H3,(H,7,8);1-2H3;/p-1.
What are the key properties of ethane;methyl(2-methylbutanoyl)azanide;yttrium?
ethane;methyl(2-methylbutanoyl)azanide;yttrium has a molecular weight of 233.14 g/mol, XLogP of 2.59, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl(2-methylbutanoyl)azanide;yttrium is sourced from PubChem (CID 177048514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).