About methylaminomethanone;methyl-[(2S)-2-methylbutanoyl]azanide;yttrium
methylaminomethanone;methyl-[(2S)-2-methylbutanoyl]azanide;yttrium (PubChem CID 59978114) has the molecular formula C8H16N2O2Y-2
and a molecular weight of 261.13 g/mol. Its IUPAC name is methylaminomethanone;methyl-[(2S)-2-methylbutanoyl]azanide;yttrium.
Molecular Properties
| Compound Name | methylaminomethanone;methyl-[(2S)-2-methylbutanoyl]azanide;yttrium |
| PubChem CID | 59978114 |
| Molecular Formula | C8H16N2O2Y-2 |
| Molecular Weight | 261.13 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | methylaminomethanone;methyl-[(2S)-2-methylbutanoyl]azanide;yttrium |
| SMILES | CC[C@H](C)C(=O)[N-]C.CN[C-]=O.[Y] |
| InChI | InChI=1S/C6H13NO.C2H4NO.Y/c1-4-5(2)6(8)7-3;1-3-2-4;/h5H,4H2,1-3H3,(H,7,8);1H3,(H,3,4);/q;-1;/p-1/t5-;;/m0../s1 |
| InChIKey | MRUDLHJPYSLFKD-XRIGFGBMSA-M |
| XLogP | 0.83 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.13 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze methylaminomethanone;methyl-[(2S)-2-methylbutanoyl]azanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylaminomethanone;methyl-[(2S)-2-methylbutanoyl]azanide;yttrium?
The IUPAC name of methylaminomethanone;methyl-[(2S)-2-methylbutanoyl]azanide;yttrium (CID 59978114) is methylaminomethanone;methyl-[(2S)-2-methylbutanoyl]azanide;yttrium.
What is the SMILES notation for methylaminomethanone;methyl-[(2S)-2-methylbutanoyl]azanide;yttrium?
The canonical SMILES for methylaminomethanone;methyl-[(2S)-2-methylbutanoyl]azanide;yttrium is CC[C@H](C)C(=O)[N-]C.CN[C-]=O.[Y].
What is the InChIKey of methylaminomethanone;methyl-[(2S)-2-methylbutanoyl]azanide;yttrium?
The InChIKey is MRUDLHJPYSLFKD-XRIGFGBMSA-M. The full InChI is InChI=1S/C6H13NO.C2H4NO.Y/c1-4-5(2)6(8)7-3;1-3-2-4;/h5H,4H2,1-3H3,(H,7,8);1H3,(H,3,4);/q;-1;/p-1/t5-;;/m0../s1.
What are the key properties of methylaminomethanone;methyl-[(2S)-2-methylbutanoyl]azanide;yttrium?
methylaminomethanone;methyl-[(2S)-2-methylbutanoyl]azanide;yttrium has a molecular weight of 261.13 g/mol, XLogP of 0.83, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methylaminomethanone;methyl-[(2S)-2-methylbutanoyl]azanide;yttrium is sourced from PubChem (CID 59978114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).