About [(2R)-2-aminobutanoyl]-methylazanide;methylaminomethanone;yttrium
[(2R)-2-aminobutanoyl]-methylazanide;methylaminomethanone;yttrium (PubChem CID 59978126) has the molecular formula C7H15N3O2Y-2
and a molecular weight of 262.12 g/mol. Its IUPAC name is [(2R)-2-aminobutanoyl]-methylazanide;methylaminomethanone;yttrium.
Molecular Properties
| Compound Name | [(2R)-2-aminobutanoyl]-methylazanide;methylaminomethanone;yttrium |
| PubChem CID | 59978126 |
| Molecular Formula | C7H15N3O2Y-2 |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | [(2R)-2-aminobutanoyl]-methylazanide;methylaminomethanone;yttrium |
| SMILES | CC[C@@H](N)C(=O)[N-]C.CN[C-]=O.[Y] |
| InChI | InChI=1S/C5H12N2O.C2H4NO.Y/c1-3-4(6)5(8)7-2;1-3-2-4;/h4H,3,6H2,1-2H3,(H,7,8);1H3,(H,3,4);/q;-1;/p-1/t4-;;/m1../s1 |
| InChIKey | KXHXRRANJBZWMA-RZFWHQLPSA-M |
| XLogP | -0.48 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-aminobutanoyl]-methylazanide;methylaminomethanone;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-aminobutanoyl]-methylazanide;methylaminomethanone;yttrium?
The IUPAC name of [(2R)-2-aminobutanoyl]-methylazanide;methylaminomethanone;yttrium (CID 59978126) is [(2R)-2-aminobutanoyl]-methylazanide;methylaminomethanone;yttrium.
What is the SMILES notation for [(2R)-2-aminobutanoyl]-methylazanide;methylaminomethanone;yttrium?
The canonical SMILES for [(2R)-2-aminobutanoyl]-methylazanide;methylaminomethanone;yttrium is CC[C@@H](N)C(=O)[N-]C.CN[C-]=O.[Y].
What is the InChIKey of [(2R)-2-aminobutanoyl]-methylazanide;methylaminomethanone;yttrium?
The InChIKey is KXHXRRANJBZWMA-RZFWHQLPSA-M. The full InChI is InChI=1S/C5H12N2O.C2H4NO.Y/c1-3-4(6)5(8)7-2;1-3-2-4;/h4H,3,6H2,1-2H3,(H,7,8);1H3,(H,3,4);/q;-1;/p-1/t4-;;/m1../s1.
What are the key properties of [(2R)-2-aminobutanoyl]-methylazanide;methylaminomethanone;yttrium?
[(2R)-2-aminobutanoyl]-methylazanide;methylaminomethanone;yttrium has a molecular weight of 262.12 g/mol, XLogP of -0.48, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-aminobutanoyl]-methylazanide;methylaminomethanone;yttrium is sourced from PubChem (CID 59978126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).