C32H32N2O13 — CID 177053341
prop-2-enyl 3-[[4-[(2S,3R,4S,6S)-3,4-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3-nitrophenyl]methoxy]quinoline-2-carboxylate (PubChem CID 177053341) has the molecular formula C32H32N2O13 and a molecular weight of 652.61 g/mol. Its IUPAC name is prop-2-enyl 3-[[4-[(2S,3R,4S,6S)-3,4-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3-nitrophenyl]methoxy]quinoline-2-carboxylate.
| Compound Name | prop-2-enyl 3-[[4-[(2S,3R,4S,6S)-3,4-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3-nitrophenyl]methoxy]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 177053341 |
| Molecular Formula | C32H32N2O13 |
| Molecular Weight | 652.61 g/mol |
| Exact Mass | 652.19 |
| IUPAC Name | prop-2-enyl 3-[[4-[(2S,3R,4S,6S)-3,4-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3-nitrophenyl]methoxy]quinoline-2-carboxylate |
| SMILES | C=CCOC(=O)c1nc2ccccc2cc1OCc1ccc(O[C@@H]2O[C@H](COC(C)=O)C[C@H](OC(C)=O)[C@H]2OC(C)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H32N2O13/c1-5-12-41-31(38)29-27(14-22-8-6-7-9-24(22)33-29)43-16-21-10-11-26(25(13-21)34(39)40)47-32-30(45-20(4)37)28(44-19(3)36)15-23(46-32)17-42-18(2)35/h5-11,13-14,23,28,30,32H,1,12,15-17H2,2-4H3/t23-,28-,30+,32-/m0/s1 |
| InChIKey | DDZFAROYTHQXDD-PRHMDTTFSA-N |
| XLogP | 3.99 |
| TPSA | 188.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|