C29H15ClF8 — CID 177054203
9-[3,5-bis(trifluoromethyl)phenyl]-10-[4-(chloromethyl)-3,5-difluorophenyl]anthracene (PubChem CID 177054203) has the molecular formula C29H15ClF8 and a molecular weight of 550.88 g/mol. Its IUPAC name is 9-[3,5-bis(trifluoromethyl)phenyl]-10-[4-(chloromethyl)-3,5-difluorophenyl]anthracene.
| Compound Name | 9-[3,5-bis(trifluoromethyl)phenyl]-10-[4-(chloromethyl)-3,5-difluorophenyl]anthracene |
|---|---|
| PubChem CID | 177054203 |
| Molecular Formula | C29H15ClF8 |
| Molecular Weight | 550.88 g/mol |
| Exact Mass | 550.07 |
| IUPAC Name | 9-[3,5-bis(trifluoromethyl)phenyl]-10-[4-(chloromethyl)-3,5-difluorophenyl]anthracene |
| SMILES | Fc1cc(-c2c3ccccc3c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3ccccc23)cc(F)c1CCl |
| InChI | InChI=1S/C29H15ClF8/c30-14-23-24(31)11-16(12-25(23)32)27-21-7-3-1-5-19(21)26(20-6-2-4-8-22(20)27)15-9-17(28(33,34)35)13-18(10-15)29(36,37)38/h1-13H,14H2 |
| InChIKey | PJLJPUXSFSEDDZ-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.88 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|