C30H45N5O4 — CID 177054542
2-[formyl-[[2-methyl-4-[4-[[1-(2-prop-2-ynoxyethyl)piperidin-4-yl]methyl]piperazin-1-yl]phenyl]methyl]amino]-N-methyl-5-oxopentanamide (PubChem CID 177054542) has the molecular formula C30H45N5O4 and a molecular weight of 539.72 g/mol. Its IUPAC name is 2-[formyl-[[2-methyl-4-[4-[[1-(2-prop-2-ynoxyethyl)piperidin-4-yl]methyl]piperazin-1-yl]phenyl]methyl]amino]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[formyl-[[2-methyl-4-[4-[[1-(2-prop-2-ynoxyethyl)piperidin-4-yl]methyl]piperazin-1-yl]phenyl]methyl]amino]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 177054542 |
| Molecular Formula | C30H45N5O4 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.35 |
| IUPAC Name | 2-[formyl-[[2-methyl-4-[4-[[1-(2-prop-2-ynoxyethyl)piperidin-4-yl]methyl]piperazin-1-yl]phenyl]methyl]amino]-N-methyl-5-oxopentanamide |
| SMILES | C#CCOCCN1CCC(CN2CCN(c3ccc(CN(C=O)C(CCC=O)C(=O)NC)c(C)c3)CC2)CC1 |
| InChI | InChI=1S/C30H45N5O4/c1-4-19-39-20-17-32-11-9-26(10-12-32)22-33-13-15-34(16-14-33)28-8-7-27(25(2)21-28)23-35(24-37)29(6-5-18-36)30(38)31-3/h1,7-8,18,21,24,26,29H,5-6,9-17,19-20,22-23H2,2-3H3,(H,31,38) |
| InChIKey | HUTLESBUYAFAST-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|