C21H29N5O2 — CID 177055216
(E)-2-[(Z)-2-[cyclohexa-2,4-dien-1-yl(formyl)amino]ethenyl]-N-[(6-ethylimino-2-methyl-2,3-dihydro-1H-pyrimidin-4-yl)methyl]but-2-enamide (PubChem CID 177055216) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is (E)-2-[(Z)-2-[cyclohexa-2,4-dien-1-yl(formyl)amino]ethenyl]-N-[(6-ethylimino-2-methyl-2,3-dihydro-1H-pyrimidin-4-yl)methyl]but-2-enamide.
| Compound Name | (E)-2-[(Z)-2-[cyclohexa-2,4-dien-1-yl(formyl)amino]ethenyl]-N-[(6-ethylimino-2-methyl-2,3-dihydro-1H-pyrimidin-4-yl)methyl]but-2-enamide |
|---|---|
| PubChem CID | 177055216 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | (E)-2-[(Z)-2-[cyclohexa-2,4-dien-1-yl(formyl)amino]ethenyl]-N-[(6-ethylimino-2-methyl-2,3-dihydro-1H-pyrimidin-4-yl)methyl]but-2-enamide |
| SMILES | C/C=C(\C=C/N(C=O)C1C=CC=CC1)C(=O)NCC1=C/C(=N\CC)NC(C)N1 |
| InChI | InChI=1S/C21H29N5O2/c1-4-17(11-12-26(15-27)19-9-7-6-8-10-19)21(28)23-14-18-13-20(22-5-2)25-16(3)24-18/h4,6-9,11-13,15-16,19,24H,5,10,14H2,1-3H3,(H,22,25)(H,23,28)/b12-11-,17-4+ |
| InChIKey | LGBGRIHPGSTSGD-WWMYKBSFSA-N |
| XLogP | 1.75 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|