C33H39N3O8S — CID 177056293
[4-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]phenyl] 2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylacetate (PubChem CID 177056293) has the molecular formula C33H39N3O8S and a molecular weight of 637.76 g/mol. Its IUPAC name is [4-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]phenyl] 2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylacetate.
| Compound Name | [4-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]phenyl] 2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 177056293 |
| Molecular Formula | C33H39N3O8S |
| Molecular Weight | 637.76 g/mol |
| Exact Mass | 637.25 |
| IUPAC Name | [4-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]phenyl] 2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylacetate |
| SMILES | CCn1c(SCC(=O)Oc2ccc(OCCOCCOCCNC(=O)OC(C)(C)C)cc2)nc2cc3ccccc3cc2c1=O |
| InChI | InChI=1S/C33H39N3O8S/c1-5-36-30(38)27-20-23-8-6-7-9-24(23)21-28(27)35-31(36)45-22-29(37)43-26-12-10-25(11-13-26)42-19-18-41-17-16-40-15-14-34-32(39)44-33(2,3)4/h6-13,20-21H,5,14-19,22H2,1-4H3,(H,34,39) |
| InChIKey | PCEPLDYVLYMGII-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.76 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|