C29H31N5O4S — CID 177056371
N-[(Z)-1-amino-3-[2-(2-hydroxyethoxy)ethylamino]prop-2-enylidene]-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-2-phenylacetamide (PubChem CID 177056371) has the molecular formula C29H31N5O4S and a molecular weight of 545.67 g/mol. Its IUPAC name is N-[(Z)-1-amino-3-[2-(2-hydroxyethoxy)ethylamino]prop-2-enylidene]-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-2-phenylacetamide.
| Compound Name | N-[(Z)-1-amino-3-[2-(2-hydroxyethoxy)ethylamino]prop-2-enylidene]-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-2-phenylacetamide |
|---|---|
| PubChem CID | 177056371 |
| Molecular Formula | C29H31N5O4S |
| Molecular Weight | 545.67 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | N-[(Z)-1-amino-3-[2-(2-hydroxyethoxy)ethylamino]prop-2-enylidene]-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-2-phenylacetamide |
| SMILES | CCn1c(SC(C(=O)/N=C(N)/C=C\NCCOCCO)c2ccccc2)nc2cc3ccccc3cc2c1=O |
| InChI | InChI=1S/C29H31N5O4S/c1-2-34-28(37)23-18-21-10-6-7-11-22(21)19-24(23)32-29(34)39-26(20-8-4-3-5-9-20)27(36)33-25(30)12-13-31-14-16-38-17-15-35/h3-13,18-19,26,31,35H,2,14-17H2,1H3,(H2,30,33,36)/b13-12- |
| InChIKey | OULMLIVRVLSLBG-SEYXRHQNSA-N |
| XLogP | 3.40 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.67 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|