C18H31N5O — CID 177057343
N-(3-hexoxypropyl)-3,3-di(imidazol-1-yl)propan-1-amine (PubChem CID 177057343) has the molecular formula C18H31N5O and a molecular weight of 333.48 g/mol. Its IUPAC name is N-(3-hexoxypropyl)-3,3-di(imidazol-1-yl)propan-1-amine.
| Compound Name | N-(3-hexoxypropyl)-3,3-di(imidazol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 177057343 |
| Molecular Formula | C18H31N5O |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | N-(3-hexoxypropyl)-3,3-di(imidazol-1-yl)propan-1-amine |
| SMILES | CCCCCCOCCCNCCC(n1ccnc1)n1ccnc1 |
| InChI | InChI=1S/C18H31N5O/c1-2-3-4-5-14-24-15-6-8-19-9-7-18(22-12-10-20-16-22)23-13-11-21-17-23/h10-13,16-19H,2-9,14-15H2,1H3 |
| InChIKey | CFOFRQQOAVFXMK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|