C20H35N5O — CID 177057356
3,3-di(imidazol-1-yl)-N-(3-octoxypropyl)propan-1-amine (PubChem CID 177057356) has the molecular formula C20H35N5O and a molecular weight of 361.53 g/mol. Its IUPAC name is 3,3-di(imidazol-1-yl)-N-(3-octoxypropyl)propan-1-amine.
| Compound Name | 3,3-di(imidazol-1-yl)-N-(3-octoxypropyl)propan-1-amine |
|---|---|
| PubChem CID | 177057356 |
| Molecular Formula | C20H35N5O |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | 3,3-di(imidazol-1-yl)-N-(3-octoxypropyl)propan-1-amine |
| SMILES | CCCCCCCCOCCCNCCC(n1ccnc1)n1ccnc1 |
| InChI | InChI=1S/C20H35N5O/c1-2-3-4-5-6-7-16-26-17-8-10-21-11-9-20(24-14-12-22-18-24)25-15-13-23-19-25/h12-15,18-21H,2-11,16-17H2,1H3 |
| InChIKey | WVXQCTXXPHNOJY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|