About 1-[(2S)-1,5-dibutoxypentan-2-yl]imidazole
1-[(2S)-1,5-dibutoxypentan-2-yl]imidazole (PubChem CID 101426270) has the molecular formula C16H30N2O2
and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-[(2S)-1,5-dibutoxypentan-2-yl]imidazole.
Molecular Properties
| Compound Name | 1-[(2S)-1,5-dibutoxypentan-2-yl]imidazole |
| PubChem CID | 101426270 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 1-[(2S)-1,5-dibutoxypentan-2-yl]imidazole |
| SMILES | CCCCOCCC[C@@H](COCCCC)n1ccnc1 |
| InChI | InChI=1S/C16H30N2O2/c1-3-5-11-19-13-7-8-16(14-20-12-6-4-2)18-10-9-17-15-18/h9-10,15-16H,3-8,11-14H2,1-2H3/t16-/m0/s1 |
| InChIKey | ZTJZZKCIFQGVCB-INIZCTEOSA-N |
| XLogP | 3.84 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2S)-1,5-dibutoxypentan-2-yl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-1,5-dibutoxypentan-2-yl]imidazole?
The IUPAC name of 1-[(2S)-1,5-dibutoxypentan-2-yl]imidazole (CID 101426270) is 1-[(2S)-1,5-dibutoxypentan-2-yl]imidazole.
What is the SMILES notation for 1-[(2S)-1,5-dibutoxypentan-2-yl]imidazole?
The canonical SMILES for 1-[(2S)-1,5-dibutoxypentan-2-yl]imidazole is CCCCOCCC[C@@H](COCCCC)n1ccnc1.
What is the InChIKey of 1-[(2S)-1,5-dibutoxypentan-2-yl]imidazole?
The InChIKey is ZTJZZKCIFQGVCB-INIZCTEOSA-N. The full InChI is InChI=1S/C16H30N2O2/c1-3-5-11-19-13-7-8-16(14-20-12-6-4-2)18-10-9-17-15-18/h9-10,15-16H,3-8,11-14H2,1-2H3/t16-/m0/s1.
What are the key properties of 1-[(2S)-1,5-dibutoxypentan-2-yl]imidazole?
1-[(2S)-1,5-dibutoxypentan-2-yl]imidazole has a molecular weight of 282.43 g/mol, XLogP of 3.84, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-1,5-dibutoxypentan-2-yl]imidazole is sourced from PubChem (CID 101426270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).