C7H11F2N3O — CID 177061670
5-(difluoromethoxymethyl)-2,4-dimethylpyrazol-3-amine (PubChem CID 177061670) has the molecular formula C7H11F2N3O and a molecular weight of 191.18 g/mol. Its IUPAC name is 5-(difluoromethoxymethyl)-2,4-dimethylpyrazol-3-amine.
| Compound Name | 5-(difluoromethoxymethyl)-2,4-dimethylpyrazol-3-amine |
|---|---|
| PubChem CID | 177061670 |
| Molecular Formula | C7H11F2N3O |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 5-(difluoromethoxymethyl)-2,4-dimethylpyrazol-3-amine |
| SMILES | Cc1c(COC(F)F)nn(C)c1N |
| InChI | InChI=1S/C7H11F2N3O/c1-4-5(3-13-7(8)9)11-12(2)6(4)10/h7H,3,10H2,1-2H3 |
| InChIKey | UHBFBQVPQYIKMC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |