C20H22FN3O3S2 — CID 177064418
4-[3-[3-(dimethyl-λ4-sulfanylidene)-2-oxopropyl]-7-methylimidazo[1,2-a]pyridin-2-yl]-3-fluoro-5-methylbenzenesulfonamide (PubChem CID 177064418) has the molecular formula C20H22FN3O3S2 and a molecular weight of 435.55 g/mol. Its IUPAC name is 4-[3-[3-(dimethyl-λ4-sulfanylidene)-2-oxopropyl]-7-methylimidazo[1,2-a]pyridin-2-yl]-3-fluoro-5-methylbenzenesulfonamide.
| Compound Name | 4-[3-[3-(dimethyl-λ4-sulfanylidene)-2-oxopropyl]-7-methylimidazo[1,2-a]pyridin-2-yl]-3-fluoro-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 177064418 |
| Molecular Formula | C20H22FN3O3S2 |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 4-[3-[3-(dimethyl-λ4-sulfanylidene)-2-oxopropyl]-7-methylimidazo[1,2-a]pyridin-2-yl]-3-fluoro-5-methylbenzenesulfonamide |
| SMILES | Cc1ccn2c(CC(=O)C=S(C)C)c(-c3c(C)cc(S(N)(=O)=O)cc3F)nc2c1 |
| InChI | InChI=1S/C20H22FN3O3S2/c1-12-5-6-24-17(9-14(25)11-28(3)4)20(23-18(24)7-12)19-13(2)8-15(10-16(19)21)29(22,26)27/h5-8,10-11H,9H2,1-4H3,(H2,22,26,27) |
| InChIKey | YKSZKDMUTOOFSJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|